C18H22N2O2S — CID 19396
3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine (PubChem CID 19396) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine.
| Compound Name | 3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 19396 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-(5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
| SMILES | CC(CN(C)C)CN1c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H22N2O2S/c1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)23(21,22)18-11-7-5-9-16(18)20/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | QTQPVLDZQVPLGV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|