C17H21ClN4O2S — CID 19398356
4-[(2-chloro-5-methylsulfanylbenzoyl)amino]-1-ethyl-N-propylpyrazole-3-carboxamide (PubChem CID 19398356) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is 4-[(2-chloro-5-methylsulfanylbenzoyl)amino]-1-ethyl-N-propylpyrazole-3-carboxamide.
| Compound Name | 4-[(2-chloro-5-methylsulfanylbenzoyl)amino]-1-ethyl-N-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19398356 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[(2-chloro-5-methylsulfanylbenzoyl)amino]-1-ethyl-N-propylpyrazole-3-carboxamide |
| SMILES | CCCNC(=O)c1nn(CC)cc1NC(=O)c1cc(SC)ccc1Cl |
| InChI | InChI=1S/C17H21ClN4O2S/c1-4-8-19-17(24)15-14(10-22(5-2)21-15)20-16(23)12-9-11(25-3)6-7-13(12)18/h6-7,9-10H,4-5,8H2,1-3H3,(H,19,24)(H,20,23) |
| InChIKey | DNDLGSFVXUCMEL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |