C19H26N4O5 — CID 19400096
1-ethyl-N-propyl-4-[(2,3,4-trimethoxybenzoyl)amino]pyrazole-3-carboxamide (PubChem CID 19400096) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-ethyl-N-propyl-4-[(2,3,4-trimethoxybenzoyl)amino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-propyl-4-[(2,3,4-trimethoxybenzoyl)amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19400096 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-ethyl-N-propyl-4-[(2,3,4-trimethoxybenzoyl)amino]pyrazole-3-carboxamide |
| SMILES | CCCNC(=O)c1nn(CC)cc1NC(=O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C19H26N4O5/c1-6-10-20-19(25)15-13(11-23(7-2)22-15)21-18(24)12-8-9-14(26-3)17(28-5)16(12)27-4/h8-9,11H,6-7,10H2,1-5H3,(H,20,25)(H,21,24) |
| InChIKey | LVBRAPNWXARWJX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |