C19H18ClN3O — CID 19400769
N-(1-benzyl-4-chloropyrazol-3-yl)-2,5-dimethylbenzamide (PubChem CID 19400769) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is N-(1-benzyl-4-chloropyrazol-3-yl)-2,5-dimethylbenzamide.
| Compound Name | N-(1-benzyl-4-chloropyrazol-3-yl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 19400769 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-(1-benzyl-4-chloropyrazol-3-yl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)Nc2nn(Cc3ccccc3)cc2Cl)c1 |
| InChI | InChI=1S/C19H18ClN3O/c1-13-8-9-14(2)16(10-13)19(24)21-18-17(20)12-23(22-18)11-15-6-4-3-5-7-15/h3-10,12H,11H2,1-2H3,(H,21,22,24) |
| InChIKey | MHRDFIKQBYFADR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |