C17H18ClN5O — CID 19474346
N-(1-benzyl-4-chloropyrazol-3-yl)-1-ethyl-3-methylpyrazole-4-carboxamide (PubChem CID 19474346) has the molecular formula C17H18ClN5O and a molecular weight of 343.82 g/mol. Its IUPAC name is N-(1-benzyl-4-chloropyrazol-3-yl)-1-ethyl-3-methylpyrazole-4-carboxamide.
| Compound Name | N-(1-benzyl-4-chloropyrazol-3-yl)-1-ethyl-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19474346 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(1-benzyl-4-chloropyrazol-3-yl)-1-ethyl-3-methylpyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2nn(Cc3ccccc3)cc2Cl)c(C)n1 |
| InChI | InChI=1S/C17H18ClN5O/c1-3-22-10-14(12(2)20-22)17(24)19-16-15(18)11-23(21-16)9-13-7-5-4-6-8-13/h4-8,10-11H,3,9H2,1-2H3,(H,19,21,24) |
| InChIKey | FCYFMLHFFQDOMB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |