C17H18N4O3 — CID 19405981
4-[4-(1H-indol-3-yl)butanoylamino]-1-methylpyrazole-5-carboxylic acid (PubChem CID 19405981) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-[4-(1H-indol-3-yl)butanoylamino]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-[4-(1H-indol-3-yl)butanoylamino]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19405981 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-[4-(1H-indol-3-yl)butanoylamino]-1-methylpyrazole-5-carboxylic acid |
| SMILES | Cn1ncc(NC(=O)CCCc2c[nH]c3ccccc23)c1C(=O)O |
| InChI | InChI=1S/C17H18N4O3/c1-21-16(17(23)24)14(10-19-21)20-15(22)8-4-5-11-9-18-13-7-3-2-6-12(11)13/h2-3,6-7,9-10,18H,4-5,8H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | SVADKSJBRLZHOH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |