C18H23N5O4S — CID 19410656
1-(benzenesulfonyl)-N-[1-methyl-3-(methylcarbamoyl)pyrazol-4-yl]piperidine-4-carboxamide (PubChem CID 19410656) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[1-methyl-3-(methylcarbamoyl)pyrazol-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[1-methyl-3-(methylcarbamoyl)pyrazol-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 19410656 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[1-methyl-3-(methylcarbamoyl)pyrazol-4-yl]piperidine-4-carboxamide |
| SMILES | CNC(=O)c1nn(C)cc1NC(=O)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H23N5O4S/c1-19-18(25)16-15(12-22(2)21-16)20-17(24)13-8-10-23(11-9-13)28(26,27)14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H,19,25)(H,20,24) |
| InChIKey | NDWXDPLDKUVHOK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |