C17H23N3O4 — CID 19410975
2-(3,4-diethoxyphenyl)-N-[1-(methoxymethyl)pyrazol-4-yl]acetamide (PubChem CID 19410975) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)-N-[1-(methoxymethyl)pyrazol-4-yl]acetamide.
| Compound Name | 2-(3,4-diethoxyphenyl)-N-[1-(methoxymethyl)pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 19410975 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)-N-[1-(methoxymethyl)pyrazol-4-yl]acetamide |
| SMILES | CCOc1ccc(CC(=O)Nc2cnn(COC)c2)cc1OCC |
| InChI | InChI=1S/C17H23N3O4/c1-4-23-15-7-6-13(8-16(15)24-5-2)9-17(21)19-14-10-18-20(11-14)12-22-3/h6-8,10-11H,4-5,9,12H2,1-3H3,(H,19,21) |
| InChIKey | PWLNRCJWQPZZLJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |