C18H25N3O4S — CID 19417475
3-[2-(dimethylamino)ethyl]-5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indole-2-carboxylic acid (PubChem CID 19417475) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-(dimethylamino)ethyl]-5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 19417475 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indole-2-carboxylic acid |
| SMILES | CN(C)CCc1c(C(=O)O)[nH]c2ccc(CS(=O)(=O)N3CCCC3)cc12 |
| InChI | InChI=1S/C18H25N3O4S/c1-20(2)10-7-14-15-11-13(5-6-16(15)19-17(14)18(22)23)12-26(24,25)21-8-3-4-9-21/h5-6,11,19H,3-4,7-10,12H2,1-2H3,(H,22,23) |
| InChIKey | DPNOUXJERSIDDG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|