C22H28N6O5S — CID 67759124
3-[2-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]ethyl]-5-(methylsulfamoylmethyl)-1H-indole-2-carboxylic acid (PubChem CID 67759124) has the molecular formula C22H28N6O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is 3-[2-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]ethyl]-5-(methylsulfamoylmethyl)-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]ethyl]-5-(methylsulfamoylmethyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 67759124 |
| Molecular Formula | C22H28N6O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 3-[2-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]ethyl]-5-(methylsulfamoylmethyl)-1H-indole-2-carboxylic acid |
| SMILES | CNS(=O)(=O)Cc1ccc2[nH]c(C(=O)O)c(CCN3CCN(c4ncncc4OC)CC3)c2c1 |
| InChI | InChI=1S/C22H28N6O5S/c1-23-34(31,32)13-15-3-4-18-17(11-15)16(20(26-18)22(29)30)5-6-27-7-9-28(10-8-27)21-19(33-2)12-24-14-25-21/h3-4,11-12,14,23,26H,5-10,13H2,1-2H3,(H,29,30) |
| InChIKey | AORYAARAPRVOKD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|