C18H14Li2 — CID 19418222
dilithium;cyclopenta-1,3-diene;1,9-dihydrofluoren-1-ide (PubChem CID 19418222) has the molecular formula C18H14Li2 and a molecular weight of 244.19 g/mol. Its IUPAC name is dilithium;cyclopenta-1,3-diene;1,9-dihydrofluoren-1-ide.
| Compound Name | dilithium;cyclopenta-1,3-diene;1,9-dihydrofluoren-1-ide |
|---|---|
| PubChem CID | 19418222 |
| Molecular Formula | C18H14Li2 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | dilithium;cyclopenta-1,3-diene;1,9-dihydrofluoren-1-ide |
| SMILES | [C-]1=CC=CC1.[Li+].[Li+].[c-]1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C13H9.C5H5.2Li/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-4-5-3-1;;/h1-5,7-8H,9H2;1-3H,4H2;;/q2*-1;2*+1 |
| InChIKey | WZLMMIBEUAZJMX-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|