C18H14Ti — CID 23102965
cyclopenta-1,3-diene;1,9-dihydrofluoren-1-ide;titanium(2+) (PubChem CID 23102965) has the molecular formula C18H14Ti and a molecular weight of 278.18 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1,9-dihydrofluoren-1-ide;titanium(2+).
| Compound Name | cyclopenta-1,3-diene;1,9-dihydrofluoren-1-ide;titanium(2+) |
|---|---|
| PubChem CID | 23102965 |
| Molecular Formula | C18H14Ti |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | cyclopenta-1,3-diene;1,9-dihydrofluoren-1-ide;titanium(2+) |
| SMILES | [C-]1=CC=CC1.[Ti+2].[c-]1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C13H9.C5H5.Ti/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-4-5-3-1;/h1-5,7-8H,9H2;1-3H,4H2;/q2*-1;+2 |
| InChIKey | ZOTIZUZPIVUVTH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|