C20H22Cl2N2O3 — CID 19422081
N-(3,4-dichlorophenyl)-5-[2,3-dihydro-1,4-benzodioxin-3-yl(methyl)amino]pentanamide (PubChem CID 19422081) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-[2,3-dihydro-1,4-benzodioxin-3-yl(methyl)amino]pentanamide.
| Compound Name | N-(3,4-dichlorophenyl)-5-[2,3-dihydro-1,4-benzodioxin-3-yl(methyl)amino]pentanamide |
|---|---|
| PubChem CID | 19422081 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-[2,3-dihydro-1,4-benzodioxin-3-yl(methyl)amino]pentanamide |
| SMILES | CN(CCCCC(=O)Nc1ccc(Cl)c(Cl)c1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-24(20-13-26-17-6-2-3-7-18(17)27-20)11-5-4-8-19(25)23-14-9-10-15(21)16(22)12-14/h2-3,6-7,9-10,12,20H,4-5,8,11,13H2,1H3,(H,23,25) |
| InChIKey | CSJZOGXFVWIHEX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|