C24H24O7S — CID 19422671
benzoic acid;methyl 2-[4-(ethylsulfonyloxymethyl)phenyl]benzoate (PubChem CID 19422671) has the molecular formula C24H24O7S and a molecular weight of 456.52 g/mol. Its IUPAC name is benzoic acid;methyl 2-[4-(ethylsulfonyloxymethyl)phenyl]benzoate.
| Compound Name | benzoic acid;methyl 2-[4-(ethylsulfonyloxymethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 19422671 |
| Molecular Formula | C24H24O7S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | benzoic acid;methyl 2-[4-(ethylsulfonyloxymethyl)phenyl]benzoate |
| SMILES | CCS(=O)(=O)OCc1ccc(-c2ccccc2C(=O)OC)cc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C17H18O5S.C7H6O2/c1-3-23(19,20)22-12-13-8-10-14(11-9-13)15-6-4-5-7-16(15)17(18)21-2;8-7(9)6-4-2-1-3-5-6/h4-11H,3,12H2,1-2H3;1-5H,(H,8,9) |
| InChIKey | SBCGALCKCHVZHM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|