C14H21N3O4 — CID 19423332
6-(3-methyl-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)hexanoic acid (PubChem CID 19423332) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 6-(3-methyl-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)hexanoic acid.
| Compound Name | 6-(3-methyl-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)hexanoic acid |
|---|---|
| PubChem CID | 19423332 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 6-(3-methyl-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)hexanoic acid |
| SMILES | Cn1c(=O)[nH]c2c(c1=O)CN(CCCCCC(=O)O)CC2 |
| InChI | InChI=1S/C14H21N3O4/c1-16-13(20)10-9-17(7-4-2-3-5-12(18)19)8-6-11(10)15-14(16)21/h2-9H2,1H3,(H,15,21)(H,18,19) |
| InChIKey | QKTAIHPRGIVERK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|