C12H19N3O3 — CID 19423338
6-(4-hydroxybutyl)-3-methyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 19423338) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-(4-hydroxybutyl)-3-methyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-(4-hydroxybutyl)-3-methyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19423338 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 6-(4-hydroxybutyl)-3-methyl-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c2c(c1=O)CN(CCCCO)CC2 |
| InChI | InChI=1S/C12H19N3O3/c1-14-11(17)9-8-15(5-2-3-7-16)6-4-10(9)13-12(14)18/h16H,2-8H2,1H3,(H,13,18) |
| InChIKey | GZFMXCGYQBCKPV-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|