C14H9Cl3N2O2 — CID 19423537
N-(3-benzoyl-2-pyridinyl)-2,2,2-trichloroacetamide (PubChem CID 19423537) has the molecular formula C14H9Cl3N2O2 and a molecular weight of 343.60 g/mol. Its IUPAC name is N-(3-benzoyl-2-pyridinyl)-2,2,2-trichloroacetamide.
| Compound Name | N-(3-benzoyl-2-pyridinyl)-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 19423537 |
| Molecular Formula | C14H9Cl3N2O2 |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | N-(3-benzoyl-2-pyridinyl)-2,2,2-trichloroacetamide |
| SMILES | O=C(c1ccccc1)c1cccnc1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H9Cl3N2O2/c15-14(16,17)13(21)19-12-10(7-4-8-18-12)11(20)9-5-2-1-3-6-9/h1-8H,(H,18,19,21) |
| InChIKey | DMGYGKIEVRPZIU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|