C20H20F2N4O3 — CID 19423814
8-[3-(2-aminoethyl)azetidin-1-yl]-1-ethyl-7,9-difluoro-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid (PubChem CID 19423814) has the molecular formula C20H20F2N4O3 and a molecular weight of 402.40 g/mol. Its IUPAC name is 8-[3-(2-aminoethyl)azetidin-1-yl]-1-ethyl-7,9-difluoro-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid.
| Compound Name | 8-[3-(2-aminoethyl)azetidin-1-yl]-1-ethyl-7,9-difluoro-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19423814 |
| Molecular Formula | C20H20F2N4O3 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 8-[3-(2-aminoethyl)azetidin-1-yl]-1-ethyl-7,9-difluoro-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc3cc(F)c(N4CC(CCN)C4)c(F)c3nc21 |
| InChI | InChI=1S/C20H20F2N4O3/c1-2-25-9-13(20(28)29)18(27)12-5-11-6-14(21)17(15(22)16(11)24-19(12)25)26-7-10(8-26)3-4-23/h5-6,9-10H,2-4,7-8,23H2,1H3,(H,28,29) |
| InChIKey | SXZSLSDTFNRUDZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|