C21H20F2N4O4 — CID 19423815
1-cyclopropyl-7,9-difluoro-8-[3-(2-hydroxyethylamino)azetidin-1-yl]-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid (PubChem CID 19423815) has the molecular formula C21H20F2N4O4 and a molecular weight of 430.41 g/mol. Its IUPAC name is 1-cyclopropyl-7,9-difluoro-8-[3-(2-hydroxyethylamino)azetidin-1-yl]-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7,9-difluoro-8-[3-(2-hydroxyethylamino)azetidin-1-yl]-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19423815 |
| Molecular Formula | C21H20F2N4O4 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-cyclopropyl-7,9-difluoro-8-[3-(2-hydroxyethylamino)azetidin-1-yl]-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2nc3c(F)c(N4CC(NCCO)C4)c(F)cc3cc2c1=O |
| InChI | InChI=1S/C21H20F2N4O4/c22-15-6-10-5-13-19(29)14(21(30)31)9-27(12-1-2-12)20(13)25-17(10)16(23)18(15)26-7-11(8-26)24-3-4-28/h5-6,9,11-12,24,28H,1-4,7-8H2,(H,30,31) |
| InChIKey | SLLVZZABJIMGSN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|