C16H10ClFN2O3 — CID 14700556
8-chloro-1-cyclopropyl-7-fluoro-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid (PubChem CID 14700556) has the molecular formula C16H10ClFN2O3 and a molecular weight of 332.72 g/mol. Its IUPAC name is 8-chloro-1-cyclopropyl-7-fluoro-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid.
| Compound Name | 8-chloro-1-cyclopropyl-7-fluoro-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 14700556 |
| Molecular Formula | C16H10ClFN2O3 |
| Molecular Weight | 332.72 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 8-chloro-1-cyclopropyl-7-fluoro-4-oxobenzo[b][1,8]naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2nc3cc(Cl)c(F)cc3cc2c1=O |
| InChI | InChI=1S/C16H10ClFN2O3/c17-11-5-13-7(4-12(11)18)3-9-14(21)10(16(22)23)6-20(8-1-2-8)15(9)19-13/h3-6,8H,1-2H2,(H,22,23) |
| InChIKey | XGORUAKVELWFLS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.72 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|