C24H21FN4O3S — CID 54508638
1-cyclopropyl-7-fluoro-4-oxo-8-(3-thiophen-2-ylpiperazin-1-yl)benzo[b][1,8]naphthyridine-3-carboxylic acid (PubChem CID 54508638) has the molecular formula C24H21FN4O3S and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-cyclopropyl-7-fluoro-4-oxo-8-(3-thiophen-2-ylpiperazin-1-yl)benzo[b][1,8]naphthyridine-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-fluoro-4-oxo-8-(3-thiophen-2-ylpiperazin-1-yl)benzo[b][1,8]naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 54508638 |
| Molecular Formula | C24H21FN4O3S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-cyclopropyl-7-fluoro-4-oxo-8-(3-thiophen-2-ylpiperazin-1-yl)benzo[b][1,8]naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2nc3cc(N4CCNC(c5cccs5)C4)c(F)cc3cc2c1=O |
| InChI | InChI=1S/C24H21FN4O3S/c25-17-9-13-8-15-22(30)16(24(31)32)11-29(14-3-4-14)23(15)27-18(13)10-20(17)28-6-5-26-19(12-28)21-2-1-7-33-21/h1-2,7-11,14,19,26H,3-6,12H2,(H,31,32) |
| InChIKey | YHNNWDJKGLFXCO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|