C21H22FN5O3 — CID 139789986
1-cyclopropyl-7-[fluoro(methyl)amino]-4-oxo-8-piperazin-1-ylbenzo[b][1,8]naphthyridine-3-carboxylic acid (PubChem CID 139789986) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is 1-cyclopropyl-7-[fluoro(methyl)amino]-4-oxo-8-piperazin-1-ylbenzo[b][1,8]naphthyridine-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-[fluoro(methyl)amino]-4-oxo-8-piperazin-1-ylbenzo[b][1,8]naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 139789986 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-cyclopropyl-7-[fluoro(methyl)amino]-4-oxo-8-piperazin-1-ylbenzo[b][1,8]naphthyridine-3-carboxylic acid |
| SMILES | CN(F)c1cc2cc3c(=O)c(C(=O)O)cn(C4CC4)c3nc2cc1N1CCNCC1 |
| InChI | InChI=1S/C21H22FN5O3/c1-25(22)17-9-12-8-14-19(28)15(21(29)30)11-27(13-2-3-13)20(14)24-16(12)10-18(17)26-6-4-23-5-7-26/h8-11,13,23H,2-7H2,1H3,(H,29,30) |
| InChIKey | NAKFQWFXDYLABD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|