C19H27NO2 — CID 19426102
2-ethyl-1-(4-methoxyphenyl)-2-piperidin-1-ylpent-4-en-1-one (PubChem CID 19426102) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-ethyl-1-(4-methoxyphenyl)-2-piperidin-1-ylpent-4-en-1-one.
| Compound Name | 2-ethyl-1-(4-methoxyphenyl)-2-piperidin-1-ylpent-4-en-1-one |
|---|---|
| PubChem CID | 19426102 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-ethyl-1-(4-methoxyphenyl)-2-piperidin-1-ylpent-4-en-1-one |
| SMILES | C=CCC(CC)(C(=O)c1ccc(OC)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H27NO2/c1-4-13-19(5-2,20-14-7-6-8-15-20)18(21)16-9-11-17(22-3)12-10-16/h4,9-12H,1,5-8,13-15H2,2-3H3 |
| InChIKey | HKXJZEDFBJOZNI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|