C39H38N7O3+ — CID 19430488
(4-amino-4-oxobut-2-ynyl) 5-ethyl-1,1-diphenyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2H-imidazol-1-ium-4-carboxylate (PubChem CID 19430488) has the molecular formula C39H38N7O3+ and a molecular weight of 652.78 g/mol. Its IUPAC name is (4-amino-4-oxobut-2-ynyl) 5-ethyl-1,1-diphenyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2H-imidazol-1-ium-4-carboxylate.
| Compound Name | (4-amino-4-oxobut-2-ynyl) 5-ethyl-1,1-diphenyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2H-imidazol-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 19430488 |
| Molecular Formula | C39H38N7O3+ |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | (4-amino-4-oxobut-2-ynyl) 5-ethyl-1,1-diphenyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2H-imidazol-1-ium-4-carboxylate |
| SMILES | CCCC1N(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)C(C(=O)OCC#CC(N)=O)=C(CC)[N+]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H37N7O3/c1-3-14-36-45(27-28-22-24-29(25-23-28)32-19-11-12-20-33(32)38-41-43-44-42-38)37(39(48)49-26-13-21-35(40)47)34(4-2)46(36,30-15-7-5-8-16-30)31-17-9-6-10-18-31/h5-12,15-20,22-25,36H,3-4,14,26-27H2,1-2H3,(H2-,40,41,42,43,44,47)/p+1 |
| InChIKey | ZTQKETAUKSGGNM-UHFFFAOYSA-O |
| XLogP | 6.47 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|