C26H17Cl4NO7S2 — CID 19430592
methyl 2-[2-[bis[(4-chlorophenyl)sulfonyl]amino]-4,5-dichlorophenoxy]benzoate (PubChem CID 19430592) has the molecular formula C26H17Cl4NO7S2 and a molecular weight of 661.37 g/mol. Its IUPAC name is methyl 2-[2-[bis[(4-chlorophenyl)sulfonyl]amino]-4,5-dichlorophenoxy]benzoate.
| Compound Name | methyl 2-[2-[bis[(4-chlorophenyl)sulfonyl]amino]-4,5-dichlorophenoxy]benzoate |
|---|---|
| PubChem CID | 19430592 |
| Molecular Formula | C26H17Cl4NO7S2 |
| Molecular Weight | 661.37 g/mol |
| Exact Mass | 658.92 |
| IUPAC Name | methyl 2-[2-[bis[(4-chlorophenyl)sulfonyl]amino]-4,5-dichlorophenoxy]benzoate |
| SMILES | COC(=O)c1ccccc1Oc1cc(Cl)c(Cl)cc1N(S(=O)(=O)c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H17Cl4NO7S2/c1-37-26(32)20-4-2-3-5-24(20)38-25-15-22(30)21(29)14-23(25)31(39(33,34)18-10-6-16(27)7-11-18)40(35,36)19-12-8-17(28)9-13-19/h2-15H,1H3 |
| InChIKey | ULXFQIYEMBXTHR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.37 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |