C19H14Cl3NO4S2 — CID 4277205
4-chloro-N-(3-chloro-2-methylphenyl)-N-(4-chlorophenyl)sulfonylbenzenesulfonamide (PubChem CID 4277205) has the molecular formula C19H14Cl3NO4S2 and a molecular weight of 490.82 g/mol. Its IUPAC name is 4-chloro-N-(3-chloro-2-methylphenyl)-N-(4-chlorophenyl)sulfonylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(3-chloro-2-methylphenyl)-N-(4-chlorophenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 4277205 |
| Molecular Formula | C19H14Cl3NO4S2 |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 488.94 |
| IUPAC Name | 4-chloro-N-(3-chloro-2-methylphenyl)-N-(4-chlorophenyl)sulfonylbenzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1N(S(=O)(=O)c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl3NO4S2/c1-13-18(22)3-2-4-19(13)23(28(24,25)16-9-5-14(20)6-10-16)29(26,27)17-11-7-15(21)8-12-17/h2-12H,1H3 |
| InChIKey | RWZWOLKJZMDUJK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |