C18H17N3O4S2 — CID 19434385
N,N-bis(4-methylsulfonylphenyl)pyrimidin-5-amine (PubChem CID 19434385) has the molecular formula C18H17N3O4S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is N,N-bis(4-methylsulfonylphenyl)pyrimidin-5-amine.
| Compound Name | N,N-bis(4-methylsulfonylphenyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19434385 |
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N,N-bis(4-methylsulfonylphenyl)pyrimidin-5-amine |
| SMILES | CS(=O)(=O)c1ccc(N(c2ccc(S(C)(=O)=O)cc2)c2cncnc2)cc1 |
| InChI | InChI=1S/C18H17N3O4S2/c1-26(22,23)17-7-3-14(4-8-17)21(16-11-19-13-20-12-16)15-5-9-18(10-6-15)27(2,24)25/h3-13H,1-2H3 |
| InChIKey | BSNBKMXRRZQMEI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |