About prop-2-enyl N-propylcarbamate
prop-2-enyl N-propylcarbamate (PubChem CID 19434675) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is prop-2-enyl N-propylcarbamate.
Molecular Properties
| Compound Name | prop-2-enyl N-propylcarbamate |
| PubChem CID | 19434675 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | prop-2-enyl N-propylcarbamate |
| SMILES | C=CCOC(=O)NCCC |
| InChI | InChI=1S/C7H13NO2/c1-3-5-8-7(9)10-6-4-2/h4H,2-3,5-6H2,1H3,(H,8,9) |
| InChIKey | VDTXNBXTAHRNDQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-propylcarbamate?
The IUPAC name of prop-2-enyl N-propylcarbamate (CID 19434675) is prop-2-enyl N-propylcarbamate.
What is the SMILES notation for prop-2-enyl N-propylcarbamate?
The canonical SMILES for prop-2-enyl N-propylcarbamate is C=CCOC(=O)NCCC.
What is the InChIKey of prop-2-enyl N-propylcarbamate?
The InChIKey is VDTXNBXTAHRNDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-5-8-7(9)10-6-4-2/h4H,2-3,5-6H2,1H3,(H,8,9).
What are the key properties of prop-2-enyl N-propylcarbamate?
prop-2-enyl N-propylcarbamate has a molecular weight of 143.19 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-propylcarbamate is sourced from PubChem (CID 19434675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).