C29H29FN2O2 — CID 19435195
2-benzyl-10-fluoro-4a-(3-methoxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol (PubChem CID 19435195) has the molecular formula C29H29FN2O2 and a molecular weight of 456.56 g/mol. Its IUPAC name is 2-benzyl-10-fluoro-4a-(3-methoxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol.
| Compound Name | 2-benzyl-10-fluoro-4a-(3-methoxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
|---|---|
| PubChem CID | 19435195 |
| Molecular Formula | C29H29FN2O2 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-benzyl-10-fluoro-4a-(3-methoxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
| SMILES | COc1cccc(C23CCN(Cc4ccccc4)CC2(O)Cc2c([nH]c4cccc(F)c24)C3)c1 |
| InChI | InChI=1S/C29H29FN2O2/c1-34-22-10-5-9-21(15-22)28-13-14-32(18-20-7-3-2-4-8-20)19-29(28,33)16-23-26(17-28)31-25-12-6-11-24(30)27(23)25/h2-12,15,31,33H,13-14,16-19H2,1H3 |
| InChIKey | FSJLQMOGENAOME-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |