C11H16N2O2 — CID 19437518
N,N',N'-tris(prop-2-enyl)oxamide (PubChem CID 19437518) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N,N',N'-tris(prop-2-enyl)oxamide.
| Compound Name | N,N',N'-tris(prop-2-enyl)oxamide |
|---|---|
| PubChem CID | 19437518 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N,N',N'-tris(prop-2-enyl)oxamide |
| SMILES | C=CCNC(=O)C(=O)N(CC=C)CC=C |
| InChI | InChI=1S/C11H16N2O2/c1-4-7-12-10(14)11(15)13(8-5-2)9-6-3/h4-6H,1-3,7-9H2,(H,12,14) |
| InChIKey | FJRNNGUHQKYLQN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|