About 2-aminopent-4-enenitrile;hydrochloride
2-aminopent-4-enenitrile;hydrochloride (PubChem CID 19438057) has the molecular formula C5H9ClN2
and a molecular weight of 132.59 g/mol. Its IUPAC name is 2-aminopent-4-enenitrile;hydrochloride.
Molecular Properties
| Compound Name | 2-aminopent-4-enenitrile;hydrochloride |
| PubChem CID | 19438057 |
| Molecular Formula | C5H9ClN2 |
| Molecular Weight | 132.59 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | 2-aminopent-4-enenitrile;hydrochloride |
| SMILES | C=CCC(N)C#N.Cl |
| InChI | InChI=1S/C5H8N2.ClH/c1-2-3-5(7)4-6;/h2,5H,1,3,7H2;1H |
| InChIKey | YGZNCUIRBMYGES-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.59 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopent-4-enenitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopent-4-enenitrile;hydrochloride?
The IUPAC name of 2-aminopent-4-enenitrile;hydrochloride (CID 19438057) is 2-aminopent-4-enenitrile;hydrochloride.
What is the SMILES notation for 2-aminopent-4-enenitrile;hydrochloride?
The canonical SMILES for 2-aminopent-4-enenitrile;hydrochloride is C=CCC(N)C#N.Cl.
What is the InChIKey of 2-aminopent-4-enenitrile;hydrochloride?
The InChIKey is YGZNCUIRBMYGES-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.ClH/c1-2-3-5(7)4-6;/h2,5H,1,3,7H2;1H.
What are the key properties of 2-aminopent-4-enenitrile;hydrochloride?
2-aminopent-4-enenitrile;hydrochloride has a molecular weight of 132.59 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopent-4-enenitrile;hydrochloride is sourced from PubChem (CID 19438057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).