C11H18N2 — CID 100988516
3-methyldeca-1,9-dien-5-yne-4,7-diamine (PubChem CID 100988516) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-methyldeca-1,9-dien-5-yne-4,7-diamine.
| Compound Name | 3-methyldeca-1,9-dien-5-yne-4,7-diamine |
|---|---|
| PubChem CID | 100988516 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-methyldeca-1,9-dien-5-yne-4,7-diamine |
| SMILES | C=CCC(N)C#CC(N)C(C)C=C |
| InChI | InChI=1S/C11H18N2/c1-4-6-10(12)7-8-11(13)9(3)5-2/h4-5,9-11H,1-2,6,12-13H2,3H3 |
| InChIKey | IOCVFWTVUYZLJL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|