C21H19F3N2O3S2 — CID 19439225
ethyl 4-[2-methylsulfanyl-N-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]anilino]-4-oxobutanoate (PubChem CID 19439225) has the molecular formula C21H19F3N2O3S2 and a molecular weight of 468.52 g/mol. Its IUPAC name is ethyl 4-[2-methylsulfanyl-N-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]anilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-methylsulfanyl-N-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 19439225 |
| Molecular Formula | C21H19F3N2O3S2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | ethyl 4-[2-methylsulfanyl-N-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]anilino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(Cc1nc2c(F)c(F)cc(F)c2s1)c1ccccc1SC |
| InChI | InChI=1S/C21H19F3N2O3S2/c1-3-29-18(28)9-8-17(27)26(14-6-4-5-7-15(14)30-2)11-16-25-20-19(24)12(22)10-13(23)21(20)31-16/h4-7,10H,3,8-9,11H2,1-2H3 |
| InChIKey | YWHLTSUFDZDKKG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|