C11H10N4O4 — CID 19439788
5-ethyl-N-(5-nitro-2-pyridinyl)-1,2-oxazole-4-carboxamide (PubChem CID 19439788) has the molecular formula C11H10N4O4 and a molecular weight of 262.22 g/mol. Its IUPAC name is 5-ethyl-N-(5-nitro-2-pyridinyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-ethyl-N-(5-nitro-2-pyridinyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 19439788 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 5-ethyl-N-(5-nitro-2-pyridinyl)-1,2-oxazole-4-carboxamide |
| SMILES | CCc1oncc1C(=O)Nc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H10N4O4/c1-2-9-8(6-13-19-9)11(16)14-10-4-3-7(5-12-10)15(17)18/h3-6H,2H2,1H3,(H,12,14,16) |
| InChIKey | RGUPHLWDPQIFGM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|