C21H23N5O4 — CID 19442643
(4-benzylpiperidin-1-yl)-[5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazol-3-yl]methanone (PubChem CID 19442643) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazol-3-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 19442643 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazol-3-yl]methanone |
| SMILES | Cc1onc(C(=O)N2CCC(Cc3ccccc3)CC2)c1Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C21H23N5O4/c1-15-18(14-25-12-9-19(22-25)26(28)29)20(23-30-15)21(27)24-10-7-17(8-11-24)13-16-5-3-2-4-6-16/h2-6,9,12,17H,7-8,10-11,13-14H2,1H3 |
| InChIKey | WJKCFGLLNLYUIX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 107.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|