C19H13F5N2O4 — CID 19442830
4-[(2-methoxyphenoxy)methyl]-5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 19442830) has the molecular formula C19H13F5N2O4 and a molecular weight of 428.31 g/mol. Its IUPAC name is 4-[(2-methoxyphenoxy)methyl]-5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 4-[(2-methoxyphenoxy)methyl]-5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442830 |
| Molecular Formula | C19H13F5N2O4 |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4-[(2-methoxyphenoxy)methyl]-5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccccc1OCc1c(C(=O)Nc2c(F)c(F)c(F)c(F)c2F)noc1C |
| InChI | InChI=1S/C19H13F5N2O4/c1-8-9(7-29-11-6-4-3-5-10(11)28-2)17(26-30-8)19(27)25-18-15(23)13(21)12(20)14(22)16(18)24/h3-6H,7H2,1-2H3,(H,25,27) |
| InChIKey | VUHLZPGJZYUMAU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|