C19H16FN3O6 — CID 19492842
4-[(2-fluorophenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 19492842) has the molecular formula C19H16FN3O6 and a molecular weight of 401.35 g/mol. Its IUPAC name is 4-[(2-fluorophenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | 4-[(2-fluorophenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19492842 |
| Molecular Formula | C19H16FN3O6 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4-[(2-fluorophenoxy)methyl]-N-(2-methoxy-4-nitrophenyl)-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1noc(C)c1COc1ccccc1F |
| InChI | InChI=1S/C19H16FN3O6/c1-11-13(10-28-16-6-4-3-5-14(16)20)18(22-29-11)19(24)21-15-8-7-12(23(25)26)9-17(15)27-2/h3-9H,10H2,1-2H3,(H,21,24) |
| InChIKey | LDDNTXDJBNYQHT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|