C25H26N2O6S — CID 19448780
propyl 5-carbamoyl-4-methyl-2-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 19448780) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is propyl 5-carbamoyl-4-methyl-2-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | propyl 5-carbamoyl-4-methyl-2-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19448780 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | propyl 5-carbamoyl-4-methyl-2-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)Nc2sc(C(N)=O)c(C)c2C(=O)OCCC)o1 |
| InChI | InChI=1S/C25H26N2O6S/c1-4-8-16-9-6-7-10-18(16)32-14-17-11-12-19(33-17)23(29)27-24-20(25(30)31-13-5-2)15(3)21(34-24)22(26)28/h4,6-7,9-12H,1,5,8,13-14H2,2-3H3,(H2,26,28)(H,27,29) |
| InChIKey | DJSNNVYFEQEQSG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|