C24H24N2O6S — CID 19448786
ethyl 5-carbamoyl-4-methyl-2-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 19448786) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is ethyl 5-carbamoyl-4-methyl-2-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-carbamoyl-4-methyl-2-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19448786 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | ethyl 5-carbamoyl-4-methyl-2-[[5-[(2-prop-2-enylphenoxy)methyl]furan-2-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)Nc2sc(C(N)=O)c(C)c2C(=O)OCC)o1 |
| InChI | InChI=1S/C24H24N2O6S/c1-4-8-15-9-6-7-10-17(15)31-13-16-11-12-18(32-16)22(28)26-23-19(24(29)30-5-2)14(3)20(33-23)21(25)27/h4,6-7,9-12H,1,5,8,13H2,2-3H3,(H2,25,27)(H,26,28) |
| InChIKey | CXSVDXNTEZFXNU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|