C11H12F7N3O — CID 19456413
N-[(1,5-dimethylpyrazol-4-yl)methyl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide (PubChem CID 19456413) has the molecular formula C11H12F7N3O and a molecular weight of 335.22 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide |
|---|---|
| PubChem CID | 19456413 |
| Molecular Formula | C11H12F7N3O |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide |
| SMILES | Cc1c(CN(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F)cnn1C |
| InChI | InChI=1S/C11H12F7N3O/c1-6-7(4-19-21(6)3)5-20(2)8(22)9(12,13)10(14,15)11(16,17)18/h4H,5H2,1-3H3 |
| InChIKey | HIZVUWUXIQRVPX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|