C15H24N4O2 — CID 56877731
2-(azepan-1-yl)-N-[(1,5-dimethylpyrazol-4-yl)methyl]-N-methyl-2-oxoacetamide (PubChem CID 56877731) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-[(1,5-dimethylpyrazol-4-yl)methyl]-N-methyl-2-oxoacetamide.
| Compound Name | 2-(azepan-1-yl)-N-[(1,5-dimethylpyrazol-4-yl)methyl]-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 56877731 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-(azepan-1-yl)-N-[(1,5-dimethylpyrazol-4-yl)methyl]-N-methyl-2-oxoacetamide |
| SMILES | Cc1c(CN(C)C(=O)C(=O)N2CCCCCC2)cnn1C |
| InChI | InChI=1S/C15H24N4O2/c1-12-13(10-16-18(12)3)11-17(2)14(20)15(21)19-8-6-4-5-7-9-19/h10H,4-9,11H2,1-3H3 |
| InChIKey | IMEWDUOBHZKFAG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|