C18H13BrCl5N3O3 — CID 19458540
N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-methyl-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19458540) has the molecular formula C18H13BrCl5N3O3 and a molecular weight of 576.49 g/mol. Its IUPAC name is N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-methyl-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-methyl-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19458540 |
| Molecular Formula | C18H13BrCl5N3O3 |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 572.86 |
| IUPAC Name | N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-methyl-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CN(Cc1c(Br)cnn1C)C(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C18H13BrCl5N3O3/c1-26(6-10-9(19)5-25-27(10)2)18(28)11-4-3-8(30-11)7-29-17-15(23)13(21)12(20)14(22)16(17)24/h3-5H,6-7H2,1-2H3 |
| InChIKey | BKDXYOBOXJCNKP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|