C13H7BrClN5O3 — CID 19462102
3-bromo-N-(4-chloro-2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19462102) has the molecular formula C13H7BrClN5O3 and a molecular weight of 396.59 g/mol. Its IUPAC name is 3-bromo-N-(4-chloro-2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 3-bromo-N-(4-chloro-2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19462102 |
| Molecular Formula | C13H7BrClN5O3 |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 394.94 |
| IUPAC Name | 3-bromo-N-(4-chloro-2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1[N+](=O)[O-])c1nn2cccnc2c1Br |
| InChI | InChI=1S/C13H7BrClN5O3/c14-10-11(18-19-5-1-4-16-12(10)19)13(21)17-8-3-2-7(15)6-9(8)20(22)23/h1-6H,(H,17,21) |
| InChIKey | KYLHHAHVVHATMM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|