C19H23ClN6S — CID 19462434
1-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-1-methyl-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19462434) has the molecular formula C19H23ClN6S and a molecular weight of 402.96 g/mol. Its IUPAC name is 1-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-1-methyl-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-1-methyl-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19462434 |
| Molecular Formula | C19H23ClN6S |
| Molecular Weight | 402.96 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-1-methyl-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | CCn1ncc(Cl)c1CN(C)C(=S)Nc1ccn(Cc2ccccc2C)n1 |
| InChI | InChI=1S/C19H23ClN6S/c1-4-26-17(16(20)11-21-26)13-24(3)19(27)22-18-9-10-25(23-18)12-15-8-6-5-7-14(15)2/h5-11H,4,12-13H2,1-3H3,(H,22,23,27) |
| InChIKey | JUXFKBCAYJMSCV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|