C18H20BrClN2O3 — CID 19463799
5-[(4-bromo-2-chlorophenoxy)methyl]-N-(1-methylpiperidin-4-yl)furan-2-carboxamide (PubChem CID 19463799) has the molecular formula C18H20BrClN2O3 and a molecular weight of 427.73 g/mol. Its IUPAC name is 5-[(4-bromo-2-chlorophenoxy)methyl]-N-(1-methylpiperidin-4-yl)furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-2-chlorophenoxy)methyl]-N-(1-methylpiperidin-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19463799 |
| Molecular Formula | C18H20BrClN2O3 |
| Molecular Weight | 427.73 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 5-[(4-bromo-2-chlorophenoxy)methyl]-N-(1-methylpiperidin-4-yl)furan-2-carboxamide |
| SMILES | CN1CCC(NC(=O)c2ccc(COc3ccc(Br)cc3Cl)o2)CC1 |
| InChI | InChI=1S/C18H20BrClN2O3/c1-22-8-6-13(7-9-22)21-18(23)17-5-3-14(25-17)11-24-16-4-2-12(19)10-15(16)20/h2-5,10,13H,6-9,11H2,1H3,(H,21,23) |
| InChIKey | SFNUJELHLSJNAX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |