C20H18N4O6 — CID 19470670
1-[3-[3-(3-methylphenoxy)-5-nitroanilino]-3-oxopropyl]pyrazole-3-carboxylic acid (PubChem CID 19470670) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is 1-[3-[3-(3-methylphenoxy)-5-nitroanilino]-3-oxopropyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[3-[3-(3-methylphenoxy)-5-nitroanilino]-3-oxopropyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19470670 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-[3-[3-(3-methylphenoxy)-5-nitroanilino]-3-oxopropyl]pyrazole-3-carboxylic acid |
| SMILES | Cc1cccc(Oc2cc(NC(=O)CCn3ccc(C(=O)O)n3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H18N4O6/c1-13-3-2-4-16(9-13)30-17-11-14(10-15(12-17)24(28)29)21-19(25)6-8-23-7-5-18(22-23)20(26)27/h2-5,7,9-12H,6,8H2,1H3,(H,21,25)(H,26,27) |
| InChIKey | RDLGLLYMDZKEGF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|