C14H13N5O7 — CID 19471305
3-[4-[(4-methyl-3,5-dinitrophenyl)carbamoyl]pyrazol-1-yl]propanoic acid (PubChem CID 19471305) has the molecular formula C14H13N5O7 and a molecular weight of 363.29 g/mol. Its IUPAC name is 3-[4-[(4-methyl-3,5-dinitrophenyl)carbamoyl]pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-[(4-methyl-3,5-dinitrophenyl)carbamoyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 19471305 |
| Molecular Formula | C14H13N5O7 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-[4-[(4-methyl-3,5-dinitrophenyl)carbamoyl]pyrazol-1-yl]propanoic acid |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)c2cnn(CCC(=O)O)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13N5O7/c1-8-11(18(23)24)4-10(5-12(8)19(25)26)16-14(22)9-6-15-17(7-9)3-2-13(20)21/h4-7H,2-3H2,1H3,(H,16,22)(H,20,21) |
| InChIKey | IFIOIPYUVZMASK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 170.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|