C20H27N9O5S — CID 19472438
[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazol-3-yl]-[4-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 19472438) has the molecular formula C20H27N9O5S and a molecular weight of 505.56 g/mol. Its IUPAC name is [1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazol-3-yl]-[4-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazol-3-yl]-[4-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19472438 |
| Molecular Formula | C20H27N9O5S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | [1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazol-3-yl]-[4-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CCn1cc(S(=O)(=O)N2CCN(C(=O)c3ccn(Cn4nc(C)c([N+](=O)[O-])c4C)n3)CC2)c(C)n1 |
| InChI | InChI=1S/C20H27N9O5S/c1-5-25-12-18(14(2)21-25)35(33,34)27-10-8-24(9-11-27)20(30)17-6-7-26(23-17)13-28-16(4)19(29(31)32)15(3)22-28/h6-7,12H,5,8-11,13H2,1-4H3 |
| InChIKey | HUDPAUBSRATANF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 154.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|