C19H29N3O — CID 19477984
N-(1-adamantyl)-1-ethyl-N,3,5-trimethylpyrazole-4-carboxamide (PubChem CID 19477984) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(1-adamantyl)-1-ethyl-N,3,5-trimethylpyrazole-4-carboxamide.
| Compound Name | N-(1-adamantyl)-1-ethyl-N,3,5-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19477984 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-(1-adamantyl)-1-ethyl-N,3,5-trimethylpyrazole-4-carboxamide |
| SMILES | CCn1nc(C)c(C(=O)N(C)C23CC4CC(CC(C4)C2)C3)c1C |
| InChI | InChI=1S/C19H29N3O/c1-5-22-13(3)17(12(2)20-22)18(23)21(4)19-9-14-6-15(10-19)8-16(7-14)11-19/h14-16H,5-11H2,1-4H3 |
| InChIKey | RLHWWTGMUBRVHJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |