C16H17Cl2IN4O — CID 19478863
[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-(4-iodo-1-methylpyrazol-5-yl)methanone (PubChem CID 19478863) has the molecular formula C16H17Cl2IN4O and a molecular weight of 479.15 g/mol. Its IUPAC name is [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-(4-iodo-1-methylpyrazol-5-yl)methanone.
| Compound Name | [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-(4-iodo-1-methylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 19478863 |
| Molecular Formula | C16H17Cl2IN4O |
| Molecular Weight | 479.15 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-(4-iodo-1-methylpyrazol-5-yl)methanone |
| SMILES | Cn1ncc(I)c1C(=O)N1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H17Cl2IN4O/c1-21-15(14(19)9-20-21)16(24)23-6-4-22(5-7-23)10-11-2-3-12(17)8-13(11)18/h2-3,8-9H,4-7,10H2,1H3 |
| InChIKey | MVMGMCDDJOFTGD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|